Synthesis, structure and magnetic properties of tetrakis-mu-carboxylato-bis(dodecylnicotinato)dicopper(II) complexes; crystal and molecular structure of the decyl carboxylate derivative
{{output}}
Dodecylnicotinate bis-adducts of binuclear copper carboxylates, of the general formula Cu2(O2CC(n-1)H(2n-1))4(C5H4NCOOC12H25)2, were synthesized for n = 10, 12, 14, 16, 18 and 20, and their crystal structure, thermal behavior and magnetic properties studied. T... ...
